C35H37N5O6S — CID 87184980
1-[4-[bis(2-methoxyethyl)amino]phenyl]-3-methyl-8-pyridin-3-ylimidazo[4,5-c]quinolin-2-one;4-methylbenzenesulfonic acid (PubChem CID 87184980) has the molecular formula C35H37N5O6S and a molecular weight of 655.78 g/mol. Its IUPAC name is 1-[4-[bis(2-methoxyethyl)amino]phenyl]-3-methyl-8-pyridin-3-ylimidazo[4,5-c]quinolin-2-one;4-methylbenzenesulfonic acid.
| Compound Name | 1-[4-[bis(2-methoxyethyl)amino]phenyl]-3-methyl-8-pyridin-3-ylimidazo[4,5-c]quinolin-2-one;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87184980 |
| Molecular Formula | C35H37N5O6S |
| Molecular Weight | 655.78 g/mol |
| Exact Mass | 655.25 |
| IUPAC Name | 1-[4-[bis(2-methoxyethyl)amino]phenyl]-3-methyl-8-pyridin-3-ylimidazo[4,5-c]quinolin-2-one;4-methylbenzenesulfonic acid |
| SMILES | COCCN(CCOC)c1ccc(-n2c(=O)n(C)c3cnc4ccc(-c5cccnc5)cc4c32)cc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C28H29N5O3.C7H8O3S/c1-31-26-19-30-25-11-6-20(21-5-4-12-29-18-21)17-24(25)27(26)33(28(31)34)23-9-7-22(8-10-23)32(13-15-35-2)14-16-36-3;1-6-2-4-7(5-3-6)11(8,9)10/h4-12,17-19H,13-16H2,1-3H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | PPMQGQUZWPVKRE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 128.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.78 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|