C39H38FN5O6S — CID 87185561
1-[4-[bis(2-methoxyethyl)amino]-3-fluorophenyl]-3-methyl-8-quinolin-3-ylimidazo[4,5-c]quinolin-2-one;4-methylbenzenesulfonic acid (PubChem CID 87185561) has the molecular formula C39H38FN5O6S and a molecular weight of 723.83 g/mol. Its IUPAC name is 1-[4-[bis(2-methoxyethyl)amino]-3-fluorophenyl]-3-methyl-8-quinolin-3-ylimidazo[4,5-c]quinolin-2-one;4-methylbenzenesulfonic acid.
| Compound Name | 1-[4-[bis(2-methoxyethyl)amino]-3-fluorophenyl]-3-methyl-8-quinolin-3-ylimidazo[4,5-c]quinolin-2-one;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87185561 |
| Molecular Formula | C39H38FN5O6S |
| Molecular Weight | 723.83 g/mol |
| Exact Mass | 723.25 |
| IUPAC Name | 1-[4-[bis(2-methoxyethyl)amino]-3-fluorophenyl]-3-methyl-8-quinolin-3-ylimidazo[4,5-c]quinolin-2-one;4-methylbenzenesulfonic acid |
| SMILES | COCCN(CCOC)c1ccc(-n2c(=O)n(C)c3cnc4ccc(-c5cnc6ccccc6c5)cc4c32)cc1F.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C32H30FN5O3.C7H8O3S/c1-36-30-20-35-28-10-8-21(23-16-22-6-4-5-7-27(22)34-19-23)17-25(28)31(30)38(32(36)39)24-9-11-29(26(33)18-24)37(12-14-40-2)13-15-41-3;1-6-2-4-7(5-3-6)11(8,9)10/h4-11,16-20H,12-15H2,1-3H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | YHSWBARNDNQSIQ-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 128.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.83 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|