C14H18Cl2O4 — CID 87186758
1-(1,2-dicarbonochloridoylcyclohexyl)ethyl 2-methylprop-2-enoate (PubChem CID 87186758) has the molecular formula C14H18Cl2O4 and a molecular weight of 321.20 g/mol. Its IUPAC name is 1-(1,2-dicarbonochloridoylcyclohexyl)ethyl 2-methylprop-2-enoate.
| Compound Name | 1-(1,2-dicarbonochloridoylcyclohexyl)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87186758 |
| Molecular Formula | C14H18Cl2O4 |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 1-(1,2-dicarbonochloridoylcyclohexyl)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)C1(C(=O)Cl)CCCCC1C(=O)Cl |
| InChI | InChI=1S/C14H18Cl2O4/c1-8(2)12(18)20-9(3)14(13(16)19)7-5-4-6-10(14)11(15)17/h9-10H,1,4-7H2,2-3H3 |
| InChIKey | HVLQSKCASIQKLI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|