C28H33N7O4S — CID 87187844
2-[4-[4-[[4-(1-hydroxypropan-2-ylamino)-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]acetaldehyde (PubChem CID 87187844) has the molecular formula C28H33N7O4S and a molecular weight of 563.68 g/mol. Its IUPAC name is 2-[4-[4-[[4-(1-hydroxypropan-2-ylamino)-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]acetaldehyde.
| Compound Name | 2-[4-[4-[[4-(1-hydroxypropan-2-ylamino)-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 87187844 |
| Molecular Formula | C28H33N7O4S |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | 2-[4-[4-[[4-(1-hydroxypropan-2-ylamino)-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]acetaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(NC(C)CO)nc(Nc4ccc(N5CCN(CC=O)CC5)cc4)nc32)cc1 |
| InChI | InChI=1S/C28H33N7O4S/c1-20-3-9-24(10-4-20)40(38,39)35-12-11-25-26(29-21(2)19-37)31-28(32-27(25)35)30-22-5-7-23(8-6-22)34-15-13-33(14-16-34)17-18-36/h3-12,18,21,37H,13-17,19H2,1-2H3,(H2,29,30,31,32) |
| InChIKey | GWXQWRJLVZWURF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 132.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|