C31H38N8O3S — CID 87187811
2-[4-[4-[[4-[4-(aminomethyl)piperidin-1-yl]-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]acetaldehyde (PubChem CID 87187811) has the molecular formula C31H38N8O3S and a molecular weight of 602.77 g/mol. Its IUPAC name is 2-[4-[4-[[4-[4-(aminomethyl)piperidin-1-yl]-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]acetaldehyde.
| Compound Name | 2-[4-[4-[[4-[4-(aminomethyl)piperidin-1-yl]-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 87187811 |
| Molecular Formula | C31H38N8O3S |
| Molecular Weight | 602.77 g/mol |
| Exact Mass | 602.28 |
| IUPAC Name | 2-[4-[4-[[4-[4-(aminomethyl)piperidin-1-yl]-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]acetaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(N4CCC(CN)CC4)nc(Nc4ccc(N5CCN(CC=O)CC5)cc4)nc32)cc1 |
| InChI | InChI=1S/C31H38N8O3S/c1-23-2-8-27(9-3-23)43(41,42)39-15-12-28-29(38-13-10-24(22-32)11-14-38)34-31(35-30(28)39)33-25-4-6-26(7-5-25)37-18-16-36(17-19-37)20-21-40/h2-9,12,15,21,24H,10-11,13-14,16-20,22,32H2,1H3,(H,33,34,35) |
| InChIKey | NPAQIIUNBMXOAJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 129.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.77 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|