C24H32N6O — CID 87632193
2-[4-[4-[(5-methyl-7-pentylpyrrolo[2,3-d]pyrimidin-2-yl)amino]phenyl]piperazin-1-yl]acetaldehyde (PubChem CID 87632193) has the molecular formula C24H32N6O and a molecular weight of 420.56 g/mol. Its IUPAC name is 2-[4-[4-[(5-methyl-7-pentylpyrrolo[2,3-d]pyrimidin-2-yl)amino]phenyl]piperazin-1-yl]acetaldehyde.
| Compound Name | 2-[4-[4-[(5-methyl-7-pentylpyrrolo[2,3-d]pyrimidin-2-yl)amino]phenyl]piperazin-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 87632193 |
| Molecular Formula | C24H32N6O |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | 2-[4-[4-[(5-methyl-7-pentylpyrrolo[2,3-d]pyrimidin-2-yl)amino]phenyl]piperazin-1-yl]acetaldehyde |
| SMILES | CCCCCn1cc(C)c2cnc(Nc3ccc(N4CCN(CC=O)CC4)cc3)nc21 |
| InChI | InChI=1S/C24H32N6O/c1-3-4-5-10-30-18-19(2)22-17-25-24(27-23(22)30)26-20-6-8-21(9-7-20)29-13-11-28(12-14-29)15-16-31/h6-9,16-18H,3-5,10-15H2,1-2H3,(H,25,26,27) |
| InChIKey | HDRWDSDTBAWLSE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|