C25H36N8O — CID 143883161
4-[4-[[4-[4-(aminomethyl)piperidin-1-yl]-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazine-1-carbaldehyde;ethane (PubChem CID 143883161) has the molecular formula C25H36N8O and a molecular weight of 464.62 g/mol. Its IUPAC name is 4-[4-[[4-[4-(aminomethyl)piperidin-1-yl]-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazine-1-carbaldehyde;ethane.
| Compound Name | 4-[4-[[4-[4-(aminomethyl)piperidin-1-yl]-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazine-1-carbaldehyde;ethane |
|---|---|
| PubChem CID | 143883161 |
| Molecular Formula | C25H36N8O |
| Molecular Weight | 464.62 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | 4-[4-[[4-[4-(aminomethyl)piperidin-1-yl]-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazine-1-carbaldehyde;ethane |
| SMILES | CC.NCC1CCN(c2nc(Nc3ccc(N4CCN(C=O)CC4)cc3)nc3[nH]ccc23)CC1 |
| InChI | InChI=1S/C23H30N8O.C2H6/c24-15-17-6-9-31(10-7-17)22-20-5-8-25-21(20)27-23(28-22)26-18-1-3-19(4-2-18)30-13-11-29(16-32)12-14-30;1-2/h1-5,8,16-17H,6-7,9-15,24H2,(H2,25,26,27,28);1-2H3 |
| InChIKey | LUCNQPZEBKAWNH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.62 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|