C18H16ClN3O3S — CID 154633635
N-[4-chloro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-6-yl]-N-cyclopropylformamide (PubChem CID 154633635) has the molecular formula C18H16ClN3O3S and a molecular weight of 389.86 g/mol. Its IUPAC name is N-[4-chloro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-6-yl]-N-cyclopropylformamide.
| Compound Name | N-[4-chloro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-6-yl]-N-cyclopropylformamide |
|---|---|
| PubChem CID | 154633635 |
| Molecular Formula | C18H16ClN3O3S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | N-[4-chloro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-6-yl]-N-cyclopropylformamide |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(Cl)cc(N(C=O)C4CC4)nc32)cc1 |
| InChI | InChI=1S/C18H16ClN3O3S/c1-12-2-6-14(7-3-12)26(24,25)22-9-8-15-16(19)10-17(20-18(15)22)21(11-23)13-4-5-13/h2-3,6-11,13H,4-5H2,1H3 |
| InChIKey | IVYDMVOORMXYLG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|