C14H20F2O3 — CID 87192096
(1-hydroxy-2-adamantyl)methyl 2,3-difluoropropanoate (PubChem CID 87192096) has the molecular formula C14H20F2O3 and a molecular weight of 274.31 g/mol. Its IUPAC name is (1-hydroxy-2-adamantyl)methyl 2,3-difluoropropanoate.
| Compound Name | (1-hydroxy-2-adamantyl)methyl 2,3-difluoropropanoate |
|---|---|
| PubChem CID | 87192096 |
| Molecular Formula | C14H20F2O3 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (1-hydroxy-2-adamantyl)methyl 2,3-difluoropropanoate |
| SMILES | O=C(OCC1C2CC3CC(C2)CC1(O)C3)C(F)CF |
| InChI | InChI=1S/C14H20F2O3/c15-6-12(16)13(17)19-7-11-10-2-8-1-9(3-10)5-14(11,18)4-8/h8-12,18H,1-7H2 |
| InChIKey | YQEBTNAGEVUBDI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |