C14H18N2O3S — CID 87195736
4-(3-pyridin-4-ylpropanoylsulfanyl)piperidine-1-carboxylic acid (PubChem CID 87195736) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 4-(3-pyridin-4-ylpropanoylsulfanyl)piperidine-1-carboxylic acid.
| Compound Name | 4-(3-pyridin-4-ylpropanoylsulfanyl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87195736 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-(3-pyridin-4-ylpropanoylsulfanyl)piperidine-1-carboxylic acid |
| SMILES | O=C(CCc1ccncc1)SC1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C14H18N2O3S/c17-13(2-1-11-3-7-15-8-4-11)20-12-5-9-16(10-6-12)14(18)19/h3-4,7-8,12H,1-2,5-6,9-10H2,(H,18,19) |
| InChIKey | WWEZPPZIPPDYFH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|