C10H14O3 — CID 87197276
2-(3-hydroxypenta-1,4-dien-2-yloxy)penta-1,4-dien-3-ol (PubChem CID 87197276) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-(3-hydroxypenta-1,4-dien-2-yloxy)penta-1,4-dien-3-ol.
| Compound Name | 2-(3-hydroxypenta-1,4-dien-2-yloxy)penta-1,4-dien-3-ol |
|---|---|
| PubChem CID | 87197276 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2-(3-hydroxypenta-1,4-dien-2-yloxy)penta-1,4-dien-3-ol |
| SMILES | C=CC(O)C(=C)OC(=C)C(O)C=C |
| InChI | InChI=1S/C10H14O3/c1-5-9(11)7(3)13-8(4)10(12)6-2/h5-6,9-12H,1-4H2 |
| InChIKey | GYVFSHDVSKOJFH-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|