C8H10F2O2 — CID 134832234
1,1-difluoro-2-prop-2-enoxypenta-1,4-dien-3-ol (PubChem CID 134832234) has the molecular formula C8H10F2O2 and a molecular weight of 176.16 g/mol. Its IUPAC name is 1,1-difluoro-2-prop-2-enoxypenta-1,4-dien-3-ol.
| Compound Name | 1,1-difluoro-2-prop-2-enoxypenta-1,4-dien-3-ol |
|---|---|
| PubChem CID | 134832234 |
| Molecular Formula | C8H10F2O2 |
| Molecular Weight | 176.16 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 1,1-difluoro-2-prop-2-enoxypenta-1,4-dien-3-ol |
| SMILES | C=CCOC(=C(F)F)C(O)C=C |
| InChI | InChI=1S/C8H10F2O2/c1-3-5-12-7(8(9)10)6(11)4-2/h3-4,6,11H,1-2,5H2 |
| InChIKey | CHHQSBIANHAFPZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.16 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|