C6H8F2O2 — CID 15215720
3,3-difluoro-2-prop-2-enoxyprop-2-en-1-ol (PubChem CID 15215720) has the molecular formula C6H8F2O2 and a molecular weight of 150.12 g/mol. Its IUPAC name is 3,3-difluoro-2-prop-2-enoxyprop-2-en-1-ol.
| Compound Name | 3,3-difluoro-2-prop-2-enoxyprop-2-en-1-ol |
|---|---|
| PubChem CID | 15215720 |
| Molecular Formula | C6H8F2O2 |
| Molecular Weight | 150.12 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 3,3-difluoro-2-prop-2-enoxyprop-2-en-1-ol |
| SMILES | C=CCOC(CO)=C(F)F |
| InChI | InChI=1S/C6H8F2O2/c1-2-3-10-5(4-9)6(7)8/h2,9H,1,3-4H2 |
| InChIKey | METYHCRBLWOVLN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.12 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|