C5H8F2O2 — CID 176925042
3-(2,2-difluoroethoxy)prop-1-en-2-ol (PubChem CID 176925042) has the molecular formula C5H8F2O2 and a molecular weight of 138.11 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)prop-1-en-2-ol.
| Compound Name | 3-(2,2-difluoroethoxy)prop-1-en-2-ol |
|---|---|
| PubChem CID | 176925042 |
| Molecular Formula | C5H8F2O2 |
| Molecular Weight | 138.11 g/mol |
| Exact Mass | 138.05 |
| IUPAC Name | 3-(2,2-difluoroethoxy)prop-1-en-2-ol |
| SMILES | C=C(O)COCC(F)F |
| InChI | InChI=1S/C5H8F2O2/c1-4(8)2-9-3-5(6)7/h5,8H,1-3H2 |
| InChIKey | STOJXHRQJRWHHL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.11 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|