C21H19ClF3N3O3 — CID 87197721
8-(2-chloropyridine-3-carbonyl)-3-[[4-(trifluoromethyl)phenyl]methyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one (PubChem CID 87197721) has the molecular formula C21H19ClF3N3O3 and a molecular weight of 453.85 g/mol. Its IUPAC name is 8-(2-chloropyridine-3-carbonyl)-3-[[4-(trifluoromethyl)phenyl]methyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 8-(2-chloropyridine-3-carbonyl)-3-[[4-(trifluoromethyl)phenyl]methyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 87197721 |
| Molecular Formula | C21H19ClF3N3O3 |
| Molecular Weight | 453.85 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 8-(2-chloropyridine-3-carbonyl)-3-[[4-(trifluoromethyl)phenyl]methyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
| SMILES | O=C1OC2(CCN(C(=O)c3cccnc3Cl)CC2)CN1Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H19ClF3N3O3/c22-17-16(2-1-9-26-17)18(29)27-10-7-20(8-11-27)13-28(19(30)31-20)12-14-3-5-15(6-4-14)21(23,24)25/h1-6,9H,7-8,10-13H2 |
| InChIKey | OJGZVJHUSAFXMB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.85 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|