C16H25NO5S — CID 87200033
tert-butyl 2-[[4-(2-methylsulfonyloxyethyl)phenyl]methylamino]acetate (PubChem CID 87200033) has the molecular formula C16H25NO5S and a molecular weight of 343.45 g/mol. Its IUPAC name is tert-butyl 2-[[4-(2-methylsulfonyloxyethyl)phenyl]methylamino]acetate.
| Compound Name | tert-butyl 2-[[4-(2-methylsulfonyloxyethyl)phenyl]methylamino]acetate |
|---|---|
| PubChem CID | 87200033 |
| Molecular Formula | C16H25NO5S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | tert-butyl 2-[[4-(2-methylsulfonyloxyethyl)phenyl]methylamino]acetate |
| SMILES | CC(C)(C)OC(=O)CNCc1ccc(CCOS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H25NO5S/c1-16(2,3)22-15(18)12-17-11-14-7-5-13(6-8-14)9-10-21-23(4,19)20/h5-8,17H,9-12H2,1-4H3 |
| InChIKey | ILPHLYVYSZUZMM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|