C16H35NO4S — CID 87200442
1-butyl-1-methylpyrrolidin-1-ium;1-propoxybutane-1-sulfonate (PubChem CID 87200442) has the molecular formula C16H35NO4S and a molecular weight of 337.53 g/mol. Its IUPAC name is 1-butyl-1-methylpyrrolidin-1-ium;1-propoxybutane-1-sulfonate.
| Compound Name | 1-butyl-1-methylpyrrolidin-1-ium;1-propoxybutane-1-sulfonate |
|---|---|
| PubChem CID | 87200442 |
| Molecular Formula | C16H35NO4S |
| Molecular Weight | 337.53 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 1-butyl-1-methylpyrrolidin-1-ium;1-propoxybutane-1-sulfonate |
| SMILES | CCCC[N+]1(C)CCCC1.CCCOC(CCC)S(=O)(=O)[O-] |
| InChI | InChI=1S/C9H20N.C7H16O4S/c1-3-4-7-10(2)8-5-6-9-10;1-3-5-7(11-6-4-2)12(8,9)10/h3-9H2,1-2H3;7H,3-6H2,1-2H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | KVIXHRSXGWMNRI-UHFFFAOYSA-M |
| XLogP | 3.11 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|