C20H30N2O4 — CID 87200778
(3aS,3bR,5aR,9aR,9bS,11aS)-7-(2-aminoethoxyimino)-9a,11a-dimethyl-3,3a,3b,5a,6,8,9,9b,10,11-decahydro-2H-indeno[4,5-c]chromene-1,4-dione (PubChem CID 87200778) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is (3aS,3bR,5aR,9aR,9bS,11aS)-7-(2-aminoethoxyimino)-9a,11a-dimethyl-3,3a,3b,5a,6,8,9,9b,10,11-decahydro-2H-indeno[4,5-c]chromene-1,4-dione.
| Compound Name | (3aS,3bR,5aR,9aR,9bS,11aS)-7-(2-aminoethoxyimino)-9a,11a-dimethyl-3,3a,3b,5a,6,8,9,9b,10,11-decahydro-2H-indeno[4,5-c]chromene-1,4-dione |
|---|---|
| PubChem CID | 87200778 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | (3aS,3bR,5aR,9aR,9bS,11aS)-7-(2-aminoethoxyimino)-9a,11a-dimethyl-3,3a,3b,5a,6,8,9,9b,10,11-decahydro-2H-indeno[4,5-c]chromene-1,4-dione |
| SMILES | C[C@]12CCC(=NOCCN)C[C@H]1OC(=O)[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C20H30N2O4/c1-19-8-6-14-17(13(19)3-4-15(19)23)18(24)26-16-11-12(22-25-10-9-21)5-7-20(14,16)2/h13-14,16-17H,3-11,21H2,1-2H3/t13-,14-,16+,17-,19-,20+/m0/s1 |
| InChIKey | SIJJGFGJUPYXKH-FDNPRCNFSA-N |
| XLogP | 2.44 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|