C25H23F3N2 — CID 87204618
3-[4-[2-[4-(2,4,5-trifluoro-3-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]phenyl]pyridine (PubChem CID 87204618) has the molecular formula C25H23F3N2 and a molecular weight of 408.47 g/mol. Its IUPAC name is 3-[4-[2-[4-(2,4,5-trifluoro-3-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]phenyl]pyridine.
| Compound Name | 3-[4-[2-[4-(2,4,5-trifluoro-3-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]phenyl]pyridine |
|---|---|
| PubChem CID | 87204618 |
| Molecular Formula | C25H23F3N2 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 3-[4-[2-[4-(2,4,5-trifluoro-3-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]phenyl]pyridine |
| SMILES | Cc1c(F)c(F)cc(C2=CCN(CCc3ccc(-c4cccnc4)cc3)CC2)c1F |
| InChI | InChI=1S/C25H23F3N2/c1-17-24(27)22(15-23(26)25(17)28)20-9-13-30(14-10-20)12-8-18-4-6-19(7-5-18)21-3-2-11-29-16-21/h2-7,9,11,15-16H,8,10,12-14H2,1H3 |
| InChIKey | OTAACHQORYSFON-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|