C31H36F3N5O4S — CID 87205440
N-[1-cyclohexyl-1-[6-[(Z)-1,2-difluoroethenyl]-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-2-oxoethyl]-4-[5-fluoro-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide (PubChem CID 87205440) has the molecular formula C31H36F3N5O4S and a molecular weight of 631.72 g/mol. Its IUPAC name is N-[1-cyclohexyl-1-[6-[(Z)-1,2-difluoroethenyl]-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-2-oxoethyl]-4-[5-fluoro-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide.
| Compound Name | N-[1-cyclohexyl-1-[6-[(Z)-1,2-difluoroethenyl]-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-2-oxoethyl]-4-[5-fluoro-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 87205440 |
| Molecular Formula | C31H36F3N5O4S |
| Molecular Weight | 631.72 g/mol |
| Exact Mass | 631.24 |
| IUPAC Name | N-[1-cyclohexyl-1-[6-[(Z)-1,2-difluoroethenyl]-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-2-oxoethyl]-4-[5-fluoro-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
| SMILES | CN1CCN(c2nc(-c3ccc(C(=O)NC(C=O)(C4CCCCC4)N4CC(/C(F)=C/F)C5OCC(=O)C54)cc3)c(F)s2)CC1 |
| InChI | InChI=1S/C31H36F3N5O4S/c1-37-11-13-38(14-12-37)30-35-25(28(34)44-30)19-7-9-20(10-8-19)29(42)36-31(18-40,21-5-3-2-4-6-21)39-16-22(23(33)15-32)27-26(39)24(41)17-43-27/h7-10,15,18,21-22,26-27H,2-6,11-14,16-17H2,1H3,(H,36,42)/b23-15- |
| InChIKey | BSSGGENAUJBHHI-HAHDFKILSA-N |
| XLogP | 3.95 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.72 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|