C28H35FN2O4Si — CID 87206596
(4S)-4-benzyl-3-[(2R)-2-[[tert-butyl(dimethyl)silyl]oxy-(5-fluoro-3-pyridinyl)methyl]hex-5-ynoyl]-1,3-oxazolidin-2-one (PubChem CID 87206596) has the molecular formula C28H35FN2O4Si and a molecular weight of 510.68 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2R)-2-[[tert-butyl(dimethyl)silyl]oxy-(5-fluoro-3-pyridinyl)methyl]hex-5-ynoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2R)-2-[[tert-butyl(dimethyl)silyl]oxy-(5-fluoro-3-pyridinyl)methyl]hex-5-ynoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 87206596 |
| Molecular Formula | C28H35FN2O4Si |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | (4S)-4-benzyl-3-[(2R)-2-[[tert-butyl(dimethyl)silyl]oxy-(5-fluoro-3-pyridinyl)methyl]hex-5-ynoyl]-1,3-oxazolidin-2-one |
| SMILES | C#CCC[C@@H](C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)C(O[Si](C)(C)C(C)(C)C)c1cncc(F)c1 |
| InChI | InChI=1S/C28H35FN2O4Si/c1-7-8-14-24(25(21-16-22(29)18-30-17-21)35-36(5,6)28(2,3)4)26(32)31-23(19-34-27(31)33)15-20-12-10-9-11-13-20/h1,9-13,16-18,23-25H,8,14-15,19H2,2-6H3/t23-,24+,25?/m0/s1 |
| InChIKey | OOUVHEFLVCNMAG-ZXABPTRBSA-N |
| XLogP | 5.90 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|