C14H14N2O3SSi — CID 87207747
(5Z)-5-[(2-trimethylsilylfuro[3,2-b]pyridin-5-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 87207747) has the molecular formula C14H14N2O3SSi and a molecular weight of 318.43 g/mol. Its IUPAC name is (5Z)-5-[(2-trimethylsilylfuro[3,2-b]pyridin-5-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(2-trimethylsilylfuro[3,2-b]pyridin-5-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87207747 |
| Molecular Formula | C14H14N2O3SSi |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | (5Z)-5-[(2-trimethylsilylfuro[3,2-b]pyridin-5-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | C[Si](C)(C)c1cc2nc(/C=C3\SC(=O)NC3=O)ccc2o1 |
| InChI | InChI=1S/C14H14N2O3SSi/c1-21(2,3)12-7-9-10(19-12)5-4-8(15-9)6-11-13(17)16-14(18)20-11/h4-7H,1-3H3,(H,16,17,18)/b11-6- |
| InChIKey | VZVOSEHRTYVEMG-WDZFZDKYSA-N |
| XLogP | 2.70 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|