C12H6FNO3S — CID 11777520
(5E)-5-[(2-fluoro-1-benzofuran-6-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 11777520) has the molecular formula C12H6FNO3S and a molecular weight of 263.25 g/mol. Its IUPAC name is (5E)-5-[(2-fluoro-1-benzofuran-6-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(2-fluoro-1-benzofuran-6-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 11777520 |
| Molecular Formula | C12H6FNO3S |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | (5E)-5-[(2-fluoro-1-benzofuran-6-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2ccc3cc(F)oc3c2)S1 |
| InChI | InChI=1S/C12H6FNO3S/c13-10-5-7-2-1-6(3-8(7)17-10)4-9-11(15)14-12(16)18-9/h1-5H,(H,14,15,16)/b9-4+ |
| InChIKey | VRUPOBLKXUKQDP-RUDMXATFSA-N |
| XLogP | 2.90 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|