C13H9NO3S — CID 10264530
(5Z)-5-[(3-methyl-1-benzofuran-5-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 10264530) has the molecular formula C13H9NO3S and a molecular weight of 259.29 g/mol. Its IUPAC name is (5Z)-5-[(3-methyl-1-benzofuran-5-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(3-methyl-1-benzofuran-5-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10264530 |
| Molecular Formula | C13H9NO3S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | (5Z)-5-[(3-methyl-1-benzofuran-5-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1coc2ccc(/C=C3\SC(=O)NC3=O)cc12 |
| InChI | InChI=1S/C13H9NO3S/c1-7-6-17-10-3-2-8(4-9(7)10)5-11-12(15)14-13(16)18-11/h2-6H,1H3,(H,14,15,16)/b11-5- |
| InChIKey | BWIVCCKWCJQICK-WZUFQYTHSA-N |
| XLogP | 3.07 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|