C23H16N2O4S — CID 87451387
(5E)-5-[[3-[(E)-3-(1,3-dihydroisoindol-2-yl)-3-oxoprop-1-enyl]-1-benzofuran-5-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 87451387) has the molecular formula C23H16N2O4S and a molecular weight of 416.46 g/mol. Its IUPAC name is (5E)-5-[[3-[(E)-3-(1,3-dihydroisoindol-2-yl)-3-oxoprop-1-enyl]-1-benzofuran-5-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-[(E)-3-(1,3-dihydroisoindol-2-yl)-3-oxoprop-1-enyl]-1-benzofuran-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87451387 |
| Molecular Formula | C23H16N2O4S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | (5E)-5-[[3-[(E)-3-(1,3-dihydroisoindol-2-yl)-3-oxoprop-1-enyl]-1-benzofuran-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2ccc3occ(/C=C/C(=O)N4Cc5ccccc5C4)c3c2)S1 |
| InChI | InChI=1S/C23H16N2O4S/c26-21(25-11-15-3-1-2-4-16(15)12-25)8-6-17-13-29-19-7-5-14(9-18(17)19)10-20-22(27)24-23(28)30-20/h1-10,13H,11-12H2,(H,24,27,28)/b8-6+,20-10+ |
| InChIKey | LYCJSKMMPUTDPB-UWWCCNHXSA-N |
| XLogP | 4.31 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|