C17H15NO5S — CID 73031041
ethyl 3-[5-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-1-benzofuran-3-yl]propanoate (PubChem CID 73031041) has the molecular formula C17H15NO5S and a molecular weight of 345.38 g/mol. Its IUPAC name is ethyl 3-[5-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-1-benzofuran-3-yl]propanoate.
| Compound Name | ethyl 3-[5-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-1-benzofuran-3-yl]propanoate |
|---|---|
| PubChem CID | 73031041 |
| Molecular Formula | C17H15NO5S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | ethyl 3-[5-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-1-benzofuran-3-yl]propanoate |
| SMILES | CCOC(=O)CCc1coc2ccc(C=C3SC(=O)NC3=O)cc12 |
| InChI | InChI=1S/C17H15NO5S/c1-2-22-15(19)6-4-11-9-23-13-5-3-10(7-12(11)13)8-14-16(20)18-17(21)24-14/h3,5,7-9H,2,4,6H2,1H3,(H,18,20,21) |
| InChIKey | YKEWNJRDWWFEKL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|