C17H19ClFN3OS — CID 8720879
N-(5-chloro-2-fluorophenyl)-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]acetamide (PubChem CID 8720879) has the molecular formula C17H19ClFN3OS and a molecular weight of 367.88 g/mol. Its IUPAC name is N-(5-chloro-2-fluorophenyl)-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]acetamide.
| Compound Name | N-(5-chloro-2-fluorophenyl)-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 8720879 |
| Molecular Formula | C17H19ClFN3OS |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | N-(5-chloro-2-fluorophenyl)-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(Cc2cccs2)CC1)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C17H19ClFN3OS/c18-13-3-4-15(19)16(10-13)20-17(23)12-22-7-5-21(6-8-22)11-14-2-1-9-24-14/h1-4,9-10H,5-8,11-12H2,(H,20,23) |
| InChIKey | FHKSESITXAWUSB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |