C29H37F3N6O7 — CID 87209945
3-amino-1-[2-(3-tert-butyl-4-methoxy-5-morpholin-4-ylphenyl)-2-oxoethyl]-7-ethoxy-N-methyl-[1,2,4]triazolo[4,3-a]pyridin-4-ium-6-carboxamide;2,2,2-trifluoroacetate (PubChem CID 87209945) has the molecular formula C29H37F3N6O7 and a molecular weight of 638.64 g/mol. Its IUPAC name is 3-amino-1-[2-(3-tert-butyl-4-methoxy-5-morpholin-4-ylphenyl)-2-oxoethyl]-7-ethoxy-N-methyl-[1,2,4]triazolo[4,3-a]pyridin-4-ium-6-carboxamide;2,2,2-trifluoroacetate.
| Compound Name | 3-amino-1-[2-(3-tert-butyl-4-methoxy-5-morpholin-4-ylphenyl)-2-oxoethyl]-7-ethoxy-N-methyl-[1,2,4]triazolo[4,3-a]pyridin-4-ium-6-carboxamide;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87209945 |
| Molecular Formula | C29H37F3N6O7 |
| Molecular Weight | 638.64 g/mol |
| Exact Mass | 638.27 |
| IUPAC Name | 3-amino-1-[2-(3-tert-butyl-4-methoxy-5-morpholin-4-ylphenyl)-2-oxoethyl]-7-ethoxy-N-methyl-[1,2,4]triazolo[4,3-a]pyridin-4-ium-6-carboxamide;2,2,2-trifluoroacetate |
| SMILES | CCOc1cc2n(CC(=O)c3cc(N4CCOCC4)c(OC)c(C(C)(C)C)c3)nc(N)[n+]2cc1C(=O)NC.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C27H36N6O5.C2HF3O2/c1-7-38-22-14-23-32(15-18(22)25(35)29-5)26(28)30-33(23)16-21(34)17-12-19(27(2,3)4)24(36-6)20(13-17)31-8-10-37-11-9-31;3-2(4,5)1(6)7/h12-15H,7-11,16H2,1-6H3,(H2-,28,29,30,35);(H,6,7) |
| InChIKey | ZPVDWSDTUHFVOE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 165.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.64 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|