C30H33F3N6O6 — CID 87210009
2-(3-amino-6-phenoxy-[1,2,4]triazolo[4,3-b]pyridazin-1-ium-1-yl)-1-(3-tert-butyl-4-methoxy-5-morpholin-4-ylphenyl)ethanone;2,2,2-trifluoroacetate (PubChem CID 87210009) has the molecular formula C30H33F3N6O6 and a molecular weight of 630.62 g/mol. Its IUPAC name is 2-(3-amino-6-phenoxy-[1,2,4]triazolo[4,3-b]pyridazin-1-ium-1-yl)-1-(3-tert-butyl-4-methoxy-5-morpholin-4-ylphenyl)ethanone;2,2,2-trifluoroacetate.
| Compound Name | 2-(3-amino-6-phenoxy-[1,2,4]triazolo[4,3-b]pyridazin-1-ium-1-yl)-1-(3-tert-butyl-4-methoxy-5-morpholin-4-ylphenyl)ethanone;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87210009 |
| Molecular Formula | C30H33F3N6O6 |
| Molecular Weight | 630.62 g/mol |
| Exact Mass | 630.24 |
| IUPAC Name | 2-(3-amino-6-phenoxy-[1,2,4]triazolo[4,3-b]pyridazin-1-ium-1-yl)-1-(3-tert-butyl-4-methoxy-5-morpholin-4-ylphenyl)ethanone;2,2,2-trifluoroacetate |
| SMILES | COc1c(N2CCOCC2)cc(C(=O)C[n+]2nc(N)n3nc(Oc4ccccc4)ccc32)cc1C(C)(C)C.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C28H33N6O4.C2HF3O2/c1-28(2,3)21-16-19(17-22(26(21)36-4)32-12-14-37-15-13-32)23(35)18-33-25-11-10-24(30-34(25)27(29)31-33)38-20-8-6-5-7-9-20;3-2(4,5)1(6)7/h5-11,16-17H,12-15,18H2,1-4H3,(H2,29,31);(H,6,7)/q+1;/p-1 |
| InChIKey | PZBZASAQBBNRAH-UHFFFAOYSA-M |
| XLogP | 2.72 |
| TPSA | 148.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.62 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|