C16H23N3O4 — CID 87214204
1-[2-hydroxy-2-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]propyl]piperidine-3-carboxylic acid (PubChem CID 87214204) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is 1-[2-hydroxy-2-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]propyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-hydroxy-2-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]propyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 87214204 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 1-[2-hydroxy-2-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]propyl]piperidine-3-carboxylic acid |
| SMILES | CC(O)(CN1CCCC(C(=O)O)C1)c1ccc(/C(N)=N/O)cc1 |
| InChI | InChI=1S/C16H23N3O4/c1-16(22,10-19-8-2-3-12(9-19)15(20)21)13-6-4-11(5-7-13)14(17)18-23/h4-7,12,22-23H,2-3,8-10H2,1H3,(H2,17,18)(H,20,21) |
| InChIKey | DMROAOMFZWOZJQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|