C20H31NO2 — CID 122040846
1-[3-(4-tert-butylphenyl)-2-methylpropyl]piperidine-3-carboxylic acid (PubChem CID 122040846) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is 1-[3-(4-tert-butylphenyl)-2-methylpropyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[3-(4-tert-butylphenyl)-2-methylpropyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122040846 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | 1-[3-(4-tert-butylphenyl)-2-methylpropyl]piperidine-3-carboxylic acid |
| SMILES | CC(Cc1ccc(C(C)(C)C)cc1)CN1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C20H31NO2/c1-15(13-21-11-5-6-17(14-21)19(22)23)12-16-7-9-18(10-8-16)20(2,3)4/h7-10,15,17H,5-6,11-14H2,1-4H3,(H,22,23) |
| InChIKey | VMVDDASUHCUQLD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |