C23H33N3O — CID 45234791
(4-tert-butylphenyl)-[1-[(1-propan-2-ylpyrazol-4-yl)methyl]piperidin-3-yl]methanone (PubChem CID 45234791) has the molecular formula C23H33N3O and a molecular weight of 367.54 g/mol. Its IUPAC name is (4-tert-butylphenyl)-[1-[(1-propan-2-ylpyrazol-4-yl)methyl]piperidin-3-yl]methanone.
| Compound Name | (4-tert-butylphenyl)-[1-[(1-propan-2-ylpyrazol-4-yl)methyl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 45234791 |
| Molecular Formula | C23H33N3O |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | (4-tert-butylphenyl)-[1-[(1-propan-2-ylpyrazol-4-yl)methyl]piperidin-3-yl]methanone |
| SMILES | CC(C)n1cc(CN2CCCC(C(=O)c3ccc(C(C)(C)C)cc3)C2)cn1 |
| InChI | InChI=1S/C23H33N3O/c1-17(2)26-15-18(13-24-26)14-25-12-6-7-20(16-25)22(27)19-8-10-21(11-9-19)23(3,4)5/h8-11,13,15,17,20H,6-7,12,14,16H2,1-5H3 |
| InChIKey | GOMVIPVQOMUEJJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |