C10H10N2O4S — CID 87216107
3-(2-methyl-3-oxo-1H-pyrazol-5-yl)benzenesulfonic acid (PubChem CID 87216107) has the molecular formula C10H10N2O4S and a molecular weight of 254.27 g/mol. Its IUPAC name is 3-(2-methyl-3-oxo-1H-pyrazol-5-yl)benzenesulfonic acid.
| Compound Name | 3-(2-methyl-3-oxo-1H-pyrazol-5-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 87216107 |
| Molecular Formula | C10H10N2O4S |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 3-(2-methyl-3-oxo-1H-pyrazol-5-yl)benzenesulfonic acid |
| SMILES | Cn1[nH]c(-c2cccc(S(=O)(=O)O)c2)cc1=O |
| InChI | InChI=1S/C10H10N2O4S/c1-12-10(13)6-9(11-12)7-3-2-4-8(5-7)17(14,15)16/h2-6,11H,1H3,(H,14,15,16) |
| InChIKey | DPZAQRPBSHDVTJ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|