C23H20Cl2N4O — CID 87216122
(E)-1-chloro-3-ethylpent-1-en-4-yn-3-ol;8-chloro-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (PubChem CID 87216122) has the molecular formula C23H20Cl2N4O and a molecular weight of 439.35 g/mol. Its IUPAC name is (E)-1-chloro-3-ethylpent-1-en-4-yn-3-ol;8-chloro-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine.
| Compound Name | (E)-1-chloro-3-ethylpent-1-en-4-yn-3-ol;8-chloro-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 87216122 |
| Molecular Formula | C23H20Cl2N4O |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | (E)-1-chloro-3-ethylpent-1-en-4-yn-3-ol;8-chloro-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| SMILES | C#CC(O)(/C=C/Cl)CC.Clc1ccc2c(c1)C(c1ccccc1)=NCc1nncn1-2 |
| InChI | InChI=1S/C16H11ClN4.C7H9ClO/c17-12-6-7-14-13(8-12)16(11-4-2-1-3-5-11)18-9-15-20-19-10-21(14)15;1-3-7(9,4-2)5-6-8/h1-8,10H,9H2;1,5-6,9H,4H2,2H3/b;6-5+ |
| InChIKey | PMWFSCNOLZEYBV-MXDQRGINSA-N |
| XLogP | 4.78 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|