C16H11ClN4 — CID 77108366
8-chloro-1,4,4-trideuterio-6-phenyl-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (PubChem CID 77108366) has the molecular formula C16H11ClN4 and a molecular weight of 297.76 g/mol. Its IUPAC name is 8-chloro-1,4,4-trideuterio-6-phenyl-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine.
| Compound Name | 8-chloro-1,4,4-trideuterio-6-phenyl-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 77108366 |
| Molecular Formula | C16H11ClN4 |
| Molecular Weight | 297.76 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 8-chloro-1,4,4-trideuterio-6-phenyl-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| SMILES | [2H]c1nnc2n1-c1ccc(Cl)cc1C(c1ccccc1)=NC2([2H])[2H] |
| InChI | InChI=1S/C16H11ClN4/c17-12-6-7-14-13(8-12)16(11-4-2-1-3-5-11)18-9-15-20-19-10-21(14)15/h1-8,10H,9H2/i9D2,10D |
| InChIKey | CDCHDCWJMGXXRH-DXTGBVBQSA-N |
| XLogP | 3.27 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.76 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |