C17H17ClN2O2 — CID 618303
7-chloro-2-methoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-ol (PubChem CID 618303) has the molecular formula C17H17ClN2O2 and a molecular weight of 316.79 g/mol. Its IUPAC name is 7-chloro-2-methoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-ol.
| Compound Name | 7-chloro-2-methoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-ol |
|---|---|
| PubChem CID | 618303 |
| Molecular Formula | C17H17ClN2O2 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 7-chloro-2-methoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-ol |
| SMILES | COC1(O)CN=C(c2ccccc2)c2cc(Cl)ccc2N1C |
| InChI | InChI=1S/C17H17ClN2O2/c1-20-15-9-8-13(18)10-14(15)16(12-6-4-3-5-7-12)19-11-17(20,21)22-2/h3-10,21H,11H2,1-2H3 |
| InChIKey | RTBMWGQHDJEEPH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|