C26H33Cl2N6O8PS — CID 87222314
[[1-[5-cyano-2-(3,5-dichlorophenoxy)phenyl]sulfonylpiperidin-4-yl]-[2-(4-methylpiperazin-1-yl)ethylcarbamoyl]amino] dihydrogen phosphate (PubChem CID 87222314) has the molecular formula C26H33Cl2N6O8PS and a molecular weight of 691.53 g/mol. Its IUPAC name is [[1-[5-cyano-2-(3,5-dichlorophenoxy)phenyl]sulfonylpiperidin-4-yl]-[2-(4-methylpiperazin-1-yl)ethylcarbamoyl]amino] dihydrogen phosphate.
| Compound Name | [[1-[5-cyano-2-(3,5-dichlorophenoxy)phenyl]sulfonylpiperidin-4-yl]-[2-(4-methylpiperazin-1-yl)ethylcarbamoyl]amino] dihydrogen phosphate |
|---|---|
| PubChem CID | 87222314 |
| Molecular Formula | C26H33Cl2N6O8PS |
| Molecular Weight | 691.53 g/mol |
| Exact Mass | 690.12 |
| IUPAC Name | [[1-[5-cyano-2-(3,5-dichlorophenoxy)phenyl]sulfonylpiperidin-4-yl]-[2-(4-methylpiperazin-1-yl)ethylcarbamoyl]amino] dihydrogen phosphate |
| SMILES | CN1CCN(CCNC(=O)N(OP(=O)(O)O)C2CCN(S(=O)(=O)c3cc(C#N)ccc3Oc3cc(Cl)cc(Cl)c3)CC2)CC1 |
| InChI | InChI=1S/C26H33Cl2N6O8PS/c1-31-10-12-32(13-11-31)9-6-30-26(35)34(42-43(36,37)38)22-4-7-33(8-5-22)44(39,40)25-14-19(18-29)2-3-24(25)41-23-16-20(27)15-21(28)17-23/h2-3,14-17,22H,4-13H2,1H3,(H,30,35)(H2,36,37,38) |
| InChIKey | GNGTVUCWLABFEY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 175.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|