C19H17ClFN3OS — CID 87222809
1-[[(2S,3R)-3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-5-ethylsulfanyl-1,2,4-triazole (PubChem CID 87222809) has the molecular formula C19H17ClFN3OS and a molecular weight of 389.88 g/mol. Its IUPAC name is 1-[[(2S,3R)-3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-5-ethylsulfanyl-1,2,4-triazole.
| Compound Name | 1-[[(2S,3R)-3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-5-ethylsulfanyl-1,2,4-triazole |
|---|---|
| PubChem CID | 87222809 |
| Molecular Formula | C19H17ClFN3OS |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 1-[[(2S,3R)-3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-5-ethylsulfanyl-1,2,4-triazole |
| SMILES | CCSc1ncnn1C[C@]1(c2ccc(F)cc2)O[C@@H]1c1ccccc1Cl |
| InChI | InChI=1S/C19H17ClFN3OS/c1-2-26-18-22-12-23-24(18)11-19(13-7-9-14(21)10-8-13)17(25-19)15-5-3-4-6-16(15)20/h3-10,12,17H,2,11H2,1H3/t17-,19-/m1/s1 |
| InChIKey | OPRSZOQJTGHESZ-IEBWSBKVSA-N |
| XLogP | 4.85 |
| TPSA | 43.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|