C18H19N9S — CID 87223323
2-[1-[(4R)-5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-4-(1,1,2,2,2-pentadeuterioethyl)-4H-[1,2,4]triazolo[4,3-f]pteridin-7-yl]imidazol-2-yl]-1,3-thiazole (PubChem CID 87223323) has the molecular formula C18H19N9S and a molecular weight of 405.55 g/mol. Its IUPAC name is 2-[1-[(4R)-5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-4-(1,1,2,2,2-pentadeuterioethyl)-4H-[1,2,4]triazolo[4,3-f]pteridin-7-yl]imidazol-2-yl]-1,3-thiazole.
| Compound Name | 2-[1-[(4R)-5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-4-(1,1,2,2,2-pentadeuterioethyl)-4H-[1,2,4]triazolo[4,3-f]pteridin-7-yl]imidazol-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 87223323 |
| Molecular Formula | C18H19N9S |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 2-[1-[(4R)-5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-4-(1,1,2,2,2-pentadeuterioethyl)-4H-[1,2,4]triazolo[4,3-f]pteridin-7-yl]imidazol-2-yl]-1,3-thiazole |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])[C@@H]1c2nncn2-c2cnc(-n3ccnc3-c3nccs3)nc2N1C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C18H19N9S/c1-4-12-15-24-22-10-26(15)13-9-21-18(23-14(13)27(12)11(2)3)25-7-5-19-16(25)17-20-6-8-28-17/h5-12H,4H2,1-3H3/t12-/m1/s1/i1D3,2D3,3D3,4D2,11D |
| InChIKey | LCUQGIWMFPXRTN-SCERIKNASA-N |
| XLogP | 3.05 |
| TPSA | 90.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |