C23H23N7 — CID 87913804
5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-4-(1,1,2,2,2-pentadeuterioethyl)-7-(3-phenyl-4-pyridinyl)-4H-[1,2,4]triazolo[4,3-f]pteridine (PubChem CID 87913804) has the molecular formula C23H23N7 and a molecular weight of 409.56 g/mol. Its IUPAC name is 5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-4-(1,1,2,2,2-pentadeuterioethyl)-7-(3-phenyl-4-pyridinyl)-4H-[1,2,4]triazolo[4,3-f]pteridine.
| Compound Name | 5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-4-(1,1,2,2,2-pentadeuterioethyl)-7-(3-phenyl-4-pyridinyl)-4H-[1,2,4]triazolo[4,3-f]pteridine |
|---|---|
| PubChem CID | 87913804 |
| Molecular Formula | C23H23N7 |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | 5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-4-(1,1,2,2,2-pentadeuterioethyl)-7-(3-phenyl-4-pyridinyl)-4H-[1,2,4]triazolo[4,3-f]pteridine |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1c2nncn2-c2cnc(-c3ccncc3-c3ccccc3)nc2N1C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C23H23N7/c1-4-19-23-28-26-14-29(23)20-13-25-21(27-22(20)30(19)15(2)3)17-10-11-24-12-18(17)16-8-6-5-7-9-16/h5-15,19H,4H2,1-3H3/i1D3,2D3,3D3,4D2,15D |
| InChIKey | UKPBIDLEVWEKEO-HBVIYBORSA-N |
| XLogP | 4.47 |
| TPSA | 72.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |