C19H14F6N6O — CID 87224504
1-[2-[difluoro-(4-fluorophenyl)methyl]-4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrrolo[1,2-a][1,3,5]triazin-6-yl]-2,2,2-trifluoroethanol (PubChem CID 87224504) has the molecular formula C19H14F6N6O and a molecular weight of 456.35 g/mol. Its IUPAC name is 1-[2-[difluoro-(4-fluorophenyl)methyl]-4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrrolo[1,2-a][1,3,5]triazin-6-yl]-2,2,2-trifluoroethanol.
| Compound Name | 1-[2-[difluoro-(4-fluorophenyl)methyl]-4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrrolo[1,2-a][1,3,5]triazin-6-yl]-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 87224504 |
| Molecular Formula | C19H14F6N6O |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 1-[2-[difluoro-(4-fluorophenyl)methyl]-4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrrolo[1,2-a][1,3,5]triazin-6-yl]-2,2,2-trifluoroethanol |
| SMILES | Cc1cc(Nc2nc(C(F)(F)c3ccc(F)cc3)nc3ccc(C(O)C(F)(F)F)n23)n[nH]1 |
| InChI | InChI=1S/C19H14F6N6O/c1-9-8-13(30-29-9)26-17-28-16(18(21,22)10-2-4-11(20)5-3-10)27-14-7-6-12(31(14)17)15(32)19(23,24)25/h2-8,15,32H,1H3,(H2,26,27,28,29,30) |
| InChIKey | SCRYDPINBGJOSS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |