C14H28N2O3 — CID 87226269
2-(hexanoylamino)-2-(trimethylazaniumyl)pentanoate (PubChem CID 87226269) has the molecular formula C14H28N2O3 and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-(hexanoylamino)-2-(trimethylazaniumyl)pentanoate.
| Compound Name | 2-(hexanoylamino)-2-(trimethylazaniumyl)pentanoate |
|---|---|
| PubChem CID | 87226269 |
| Molecular Formula | C14H28N2O3 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | 2-(hexanoylamino)-2-(trimethylazaniumyl)pentanoate |
| SMILES | CCCCCC(=O)NC(CCC)(C(=O)[O-])[N+](C)(C)C |
| InChI | InChI=1S/C14H28N2O3/c1-6-8-9-10-12(17)15-14(11-7-2,13(18)19)16(3,4)5/h6-11H2,1-5H3,(H-,15,17,18,19) |
| InChIKey | SLKDYWWMGDFJMG-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|