C27H47NO3 — CID 87226453
4-[(3R,3aR,5aS,6R,7E,9aS,9bS)-7-hydroxyimino-3a,6-dimethyl-3-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl]butanoic acid (PubChem CID 87226453) has the molecular formula C27H47NO3 and a molecular weight of 433.68 g/mol. Its IUPAC name is 4-[(3R,3aR,5aS,6R,7E,9aS,9bS)-7-hydroxyimino-3a,6-dimethyl-3-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl]butanoic acid.
| Compound Name | 4-[(3R,3aR,5aS,6R,7E,9aS,9bS)-7-hydroxyimino-3a,6-dimethyl-3-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl]butanoic acid |
|---|---|
| PubChem CID | 87226453 |
| Molecular Formula | C27H47NO3 |
| Molecular Weight | 433.68 g/mol |
| Exact Mass | 433.36 |
| IUPAC Name | 4-[(3R,3aR,5aS,6R,7E,9aS,9bS)-7-hydroxyimino-3a,6-dimethyl-3-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl]butanoic acid |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC/C(=N\O)[C@](C)(CCCC(=O)O)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H47NO3/c1-18(2)8-6-9-19(3)21-12-13-22-20-11-14-24(28-31)27(5,16-7-10-25(29)30)23(20)15-17-26(21,22)4/h18-23,31H,6-17H2,1-5H3,(H,29,30)/b28-24+/t19-,20+,21-,22+,23+,26-,27-/m1/s1 |
| InChIKey | RDCHLQNTRXKZDJ-INECXOSNSA-N |
| XLogP | 7.39 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.68 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|