C27H45NO — CID 87226563
N-[(3R,3aR,5aS,6R,9aS,9bS)-6-but-3-ynyl-3a,6-dimethyl-3-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-7-ylidene]hydroxylamine (PubChem CID 87226563) has the molecular formula C27H45NO and a molecular weight of 399.66 g/mol. Its IUPAC name is N-[(3R,3aR,5aS,6R,9aS,9bS)-6-but-3-ynyl-3a,6-dimethyl-3-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-7-ylidene]hydroxylamine.
| Compound Name | N-[(3R,3aR,5aS,6R,9aS,9bS)-6-but-3-ynyl-3a,6-dimethyl-3-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-7-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 87226563 |
| Molecular Formula | C27H45NO |
| Molecular Weight | 399.66 g/mol |
| Exact Mass | 399.35 |
| IUPAC Name | N-[(3R,3aR,5aS,6R,9aS,9bS)-6-but-3-ynyl-3a,6-dimethyl-3-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-7-ylidene]hydroxylamine |
| SMILES | C#CCC[C@@]1(C)C(=NO)CC[C@H]2[C@@H]3CC[C@H]([C@H](C)CCCC(C)C)[C@@]3(C)CC[C@@H]21 |
| InChI | InChI=1S/C27H45NO/c1-7-8-17-27(6)24-16-18-26(5)22(20(4)11-9-10-19(2)3)13-14-23(26)21(24)12-15-25(27)28-29/h1,19-24,29H,8-18H2,2-6H3/t20-,21+,22-,23+,24+,26-,27-/m1/s1 |
| InChIKey | LYVCIXHYYILROT-PUOFIRGJSA-N |
| XLogP | 7.55 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.66 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|