C27H44BrNO — CID 87257893
N-[(8S,9S,10R,13R,14S,17R)-4-bromo-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]hydroxylamine (PubChem CID 87257893) has the molecular formula C27H44BrNO and a molecular weight of 478.56 g/mol. Its IUPAC name is N-[(8S,9S,10R,13R,14S,17R)-4-bromo-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]hydroxylamine.
| Compound Name | N-[(8S,9S,10R,13R,14S,17R)-4-bromo-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 87257893 |
| Molecular Formula | C27H44BrNO |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | N-[(8S,9S,10R,13R,14S,17R)-4-bromo-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]hydroxylamine |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4=C(Br)C(=NO)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H44BrNO/c1-17(2)7-6-8-18(3)20-11-12-21-19-9-10-23-25(28)24(29-30)14-16-27(23,5)22(19)13-15-26(20,21)4/h17-22,30H,6-16H2,1-5H3/t18-,19+,20-,21+,22+,26-,27-/m1/s1 |
| InChIKey | NACWTCYHROHQLG-OLZFZNDLSA-N |
| XLogP | 8.58 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|