C28H47NO — CID 87257874
N-[(8S,9S,10R,13R,14S,17R)-4,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]hydroxylamine (PubChem CID 87257874) has the molecular formula C28H47NO and a molecular weight of 413.69 g/mol. Its IUPAC name is N-[(8S,9S,10R,13R,14S,17R)-4,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]hydroxylamine.
| Compound Name | N-[(8S,9S,10R,13R,14S,17R)-4,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 87257874 |
| Molecular Formula | C28H47NO |
| Molecular Weight | 413.69 g/mol |
| Exact Mass | 413.37 |
| IUPAC Name | N-[(8S,9S,10R,13R,14S,17R)-4,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]hydroxylamine |
| SMILES | CC1=C2CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]3[C@@]2(C)CCC1=NO |
| InChI | InChI=1S/C28H47NO/c1-18(2)8-7-9-19(3)22-12-13-24-21-10-11-23-20(4)26(29-30)15-17-28(23,6)25(21)14-16-27(22,24)5/h18-19,21-22,24-25,30H,7-17H2,1-6H3/t19-,21+,22-,24+,25+,27-,28+/m1/s1 |
| InChIKey | GJNIFLCYWVFYKO-QRLHXZIHSA-N |
| XLogP | 8.25 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.69 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|