C26H25FN6O2S — CID 87229959
N-[[(1S,2S,5R)-3-[2-amino-5-(3-fluorophenyl)-1,3-thiazole-4-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]-2,8-dimethylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 87229959) has the molecular formula C26H25FN6O2S and a molecular weight of 504.59 g/mol. Its IUPAC name is N-[[(1S,2S,5R)-3-[2-amino-5-(3-fluorophenyl)-1,3-thiazole-4-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]-2,8-dimethylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-[[(1S,2S,5R)-3-[2-amino-5-(3-fluorophenyl)-1,3-thiazole-4-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]-2,8-dimethylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87229959 |
| Molecular Formula | C26H25FN6O2S |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | N-[[(1S,2S,5R)-3-[2-amino-5-(3-fluorophenyl)-1,3-thiazole-4-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]-2,8-dimethylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | Cc1nc2c(C)cccn2c1C(=O)NC[C@@H]1[C@H]2C[C@H]2CN1C(=O)c1nc(N)sc1-c1cccc(F)c1 |
| InChI | InChI=1S/C26H25FN6O2S/c1-13-5-4-8-32-21(14(2)30-23(13)32)24(34)29-11-19-18-10-16(18)12-33(19)25(35)20-22(36-26(28)31-20)15-6-3-7-17(27)9-15/h3-9,16,18-19H,10-12H2,1-2H3,(H2,28,31)(H,29,34)/t16-,18-,19+/m0/s1 |
| InChIKey | CZRAABJBGSQUOU-YTQUADARSA-N |
| XLogP | 3.69 |
| TPSA | 105.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |