C17H20FN3O3S2 — CID 87230096
N-[4-fluoro-2-(2-methylpropoxy)phenyl]-N'-(5-methylsulfanyl-1,3-thiazol-2-yl)propanediamide (PubChem CID 87230096) has the molecular formula C17H20FN3O3S2 and a molecular weight of 397.50 g/mol. Its IUPAC name is N-[4-fluoro-2-(2-methylpropoxy)phenyl]-N'-(5-methylsulfanyl-1,3-thiazol-2-yl)propanediamide.
| Compound Name | N-[4-fluoro-2-(2-methylpropoxy)phenyl]-N'-(5-methylsulfanyl-1,3-thiazol-2-yl)propanediamide |
|---|---|
| PubChem CID | 87230096 |
| Molecular Formula | C17H20FN3O3S2 |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | N-[4-fluoro-2-(2-methylpropoxy)phenyl]-N'-(5-methylsulfanyl-1,3-thiazol-2-yl)propanediamide |
| SMILES | CSc1cnc(NC(=O)CC(=O)Nc2ccc(F)cc2OCC(C)C)s1 |
| InChI | InChI=1S/C17H20FN3O3S2/c1-10(2)9-24-13-6-11(18)4-5-12(13)20-14(22)7-15(23)21-17-19-8-16(25-3)26-17/h4-6,8,10H,7,9H2,1-3H3,(H,20,22)(H,19,21,23) |
| InChIKey | PDBWNEXNSYUVBS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|