C19H17N3O4S2 — CID 87231555
N-[2-(2-methoxyphenoxy)phenyl]-N'-(5-methylsulfanyl-1,3-thiazol-2-yl)oxamide (PubChem CID 87231555) has the molecular formula C19H17N3O4S2 and a molecular weight of 415.50 g/mol. Its IUPAC name is N-[2-(2-methoxyphenoxy)phenyl]-N'-(5-methylsulfanyl-1,3-thiazol-2-yl)oxamide.
| Compound Name | N-[2-(2-methoxyphenoxy)phenyl]-N'-(5-methylsulfanyl-1,3-thiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 87231555 |
| Molecular Formula | C19H17N3O4S2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | N-[2-(2-methoxyphenoxy)phenyl]-N'-(5-methylsulfanyl-1,3-thiazol-2-yl)oxamide |
| SMILES | COc1ccccc1Oc1ccccc1NC(=O)C(=O)Nc1ncc(SC)s1 |
| InChI | InChI=1S/C19H17N3O4S2/c1-25-14-9-5-6-10-15(14)26-13-8-4-3-7-12(13)21-17(23)18(24)22-19-20-11-16(27-2)28-19/h3-11H,1-2H3,(H,21,23)(H,20,22,24) |
| InChIKey | CTSCOJUKXSYQIV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|