C21H16FN5O4S2 — CID 87230514
N-[4-fluoro-2-(2-methoxyphenoxy)phenyl]-N'-[5-(1H-imidazol-2-ylsulfanyl)-1,3-thiazol-2-yl]oxamide (PubChem CID 87230514) has the molecular formula C21H16FN5O4S2 and a molecular weight of 485.52 g/mol. Its IUPAC name is N-[4-fluoro-2-(2-methoxyphenoxy)phenyl]-N'-[5-(1H-imidazol-2-ylsulfanyl)-1,3-thiazol-2-yl]oxamide.
| Compound Name | N-[4-fluoro-2-(2-methoxyphenoxy)phenyl]-N'-[5-(1H-imidazol-2-ylsulfanyl)-1,3-thiazol-2-yl]oxamide |
|---|---|
| PubChem CID | 87230514 |
| Molecular Formula | C21H16FN5O4S2 |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | N-[4-fluoro-2-(2-methoxyphenoxy)phenyl]-N'-[5-(1H-imidazol-2-ylsulfanyl)-1,3-thiazol-2-yl]oxamide |
| SMILES | COc1ccccc1Oc1cc(F)ccc1NC(=O)C(=O)Nc1ncc(Sc2ncc[nH]2)s1 |
| InChI | InChI=1S/C21H16FN5O4S2/c1-30-14-4-2-3-5-15(14)31-16-10-12(22)6-7-13(16)26-18(28)19(29)27-21-25-11-17(33-21)32-20-23-8-9-24-20/h2-11H,1H3,(H,23,24)(H,26,28)(H,25,27,29) |
| InChIKey | ZRHIHTFABXEVQY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|